Products 66063-44-3
CAS 66063-44-3 is the registry number for Geraniol-d6. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
(2E)-8,8,8-trideuterio-3-methyl-7-(trideuteriomethyl)octa-2,6-dien-1-ol (CAS 66063-44-3) is a chemical compound with the molecular formula C10H18O and a molecular weight of 160.29 g/mol. IUPAC name: (2E)-8,8,8-trideuterio-3-methyl-7-(trideuteriomethyl)octa-2,6-dien-1-ol. InChIKey: GLZPCOQZEFWAFX-VXNAPGOLSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 160.29 g/mol |
| IUPAC name | (2E)-8,8,8-trideuterio-3-methyl-7-(trideuteriomethyl)octa-2,6-dien-1-ol |
| InChIKey | GLZPCOQZEFWAFX-VXNAPGOLSA-N |
| SMILES | [2H]C([2H])([2H])C(=CCC/C(=C/CO)/C)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)