Products 166196-77-6
CAS 166196-77-6 is the registry number for 1-(3-Chloro-2-thienyl)-3-(dimethylamino)-2-propen-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-1-(3-chlorothiophen-2-yl)-3-(dimethylamino)prop-2-en-1-one (CAS 166196-77-6) is a chemical compound with the molecular formula C9H10ClNOS and a molecular weight of 215.70 g/mol. IUPAC name: (E)-1-(3-chlorothiophen-2-yl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: JDJRLADAALOSDU-HWKANZROSA-N.
| Molecular formula | C9H10ClNOS |
|---|---|
| Molecular weight | 215.70 g/mol |
| IUPAC name | (E)-1-(3-chlorothiophen-2-yl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | JDJRLADAALOSDU-HWKANZROSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=C(C=CS1)Cl |
Computed by PubChem (NCBI)