CAS 929974-47-0 appears in our catalog under these names: 5-(Chloroacetyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine, 95%, 2-Chloro-1-{4H,5H,6H,7H-thieno(3,2-c)pyridin-5-yl}ethan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g.
2-chloro-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone (CAS 929974-47-0) is a chemical compound with the molecular formula C9H10ClNOS and a molecular weight of 215.70 g/mol. IUPAC name: 2-chloro-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone. InChIKey: QSRTWFRGDFZQPO-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNOS |
|---|---|
| Molecular weight | 215.70 g/mol |
| IUPAC name | 2-chloro-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethanone |
| InChIKey | QSRTWFRGDFZQPO-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1SC=C2)C(=O)CCl |
Computed by PubChem (NCBI)