CAS 1662687-74-2 is the registry number for 4-(Benzyloxy)-8-methyl-2-naphthoic Acid, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
8-methyl-4-phenylmethoxynaphthalene-2-carboxylic acid (CAS 1662687-74-2) is a chemical compound with the molecular formula C19H16O3 and a molecular weight of 292.3 g/mol. IUPAC name: 8-methyl-4-phenylmethoxynaphthalene-2-carboxylic acid. InChIKey: JCRPWONFCIOOTF-UHFFFAOYSA-N.
| Molecular formula | C19H16O3 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 8-methyl-4-phenylmethoxynaphthalene-2-carboxylic acid |
| InChIKey | JCRPWONFCIOOTF-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C=C(C2=CC=C1)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)