Products 1662687-74-2

CAS 1662687-74-2 is the registry number for 4-(Benzyloxy)-8-methyl-2-naphthoic Acid, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

8-methyl-4-phenylmethoxynaphthalene-2-carboxylic acid (CAS 1662687-74-2) is a chemical compound with the molecular formula C19H16O3 and a molecular weight of 292.3 g/mol. IUPAC name: 8-methyl-4-phenylmethoxynaphthalene-2-carboxylic acid. InChIKey: JCRPWONFCIOOTF-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16O3
Molecular weight292.3 g/mol
IUPAC name8-methyl-4-phenylmethoxynaphthalene-2-carboxylic acid
InChIKeyJCRPWONFCIOOTF-UHFFFAOYSA-N
SMILESCC1=C2C=C(C=C(C2=CC=C1)OCC3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)