Products 94305-64-3
CAS 94305-64-3 is the registry number for a-(6-Methoxy-2-naphthyl)-o-toluic Acid (>85%). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
2-[(6-methoxynaphthalen-2-yl)methyl]benzoic acid (CAS 94305-64-3) is a chemical compound with the molecular formula C19H16O3 and a molecular weight of 292.3 g/mol. IUPAC name: 2-[(6-methoxynaphthalen-2-yl)methyl]benzoic acid. InChIKey: SONIGKHPDBMDOQ-UHFFFAOYSA-N.
| Molecular formula | C19H16O3 |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 2-[(6-methoxynaphthalen-2-yl)methyl]benzoic acid |
| InChIKey | SONIGKHPDBMDOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)CC3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-[(6-methoxynaphthalen-2-yl)methyl]benzoic Acid, alpha-(6-Methoxy-2-naphthyl)-o-toluic Acid, a-(6-Methoxy-2-naphthyl)-o-toluic Acid, 2-((6-Methoxynaphthalen-2-yl)methyl)benzoic acid, 2-[(6-Methoxy-2-naphthalenyl)methyl]benzoic Acid, starbld0043137, Benzoic aid, 2-((6-methoxy-2-naphthalenyl)methyl)-, a-(6-Methoxy-2-naphthyl)-o-toluic Acid (>85%)