CAS 16636-51-4 appears in our catalog under these names: Cis-3-aminocyclohexanecarboxylic acid, 90%, cis–3–Aminocyclohexanecarboxylic Acid, cis-3-Aminocyclohexanecarboxylic Acid, >96.0%(GC)(T), cis-3-Aminocyclohexanecarboxylic acid 90%, cis-3-Aminocyclohexanecarboxylic acid 96%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100g, 10g, 250mg, 50g.
Cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid (CAS 16636-51-4) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid. InChIKey: CKTUXQBZPWBFDX-RITPCOANSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid |
| InChIKey | CKTUXQBZPWBFDX-RITPCOANSA-N |
| SMILES | C1C[C@H](C[C@H](C1)N)C(=O)O |
Computed by PubChem (NCBI)