CAS 81131-39-7 appears in our catalog under these names: (1r,3s)-3-Aminocyclohexanecarboxylic acid, 90%, (1R,3S)-3-Aminocyclohexanecarboxylic acid, 98+%, (1R,3S)–3–Aminocyclohexanecarboxylic Acid, (1R,3S)-3-Aminocyclohexanecarboxylic Acid, >98.0%(T)(GC), (1R,3S)-3-Aminocyclohexanecarboxylic Acid, ≥98%(GC)(T), ≥98%(GC)(T). Offered by: Combi-blocks, Chemat Brand, GLPBio, TCI, Chemat. Available pack sizes: 1g, 250mg, on request, 50mg, 200mg.
Cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid (CAS 81131-39-7) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid. InChIKey: CKTUXQBZPWBFDX-RITPCOANSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid |
| InChIKey | CKTUXQBZPWBFDX-RITPCOANSA-N |
| SMILES | C1C[C@H](C[C@H](C1)N)C(=O)O |
Computed by PubChem (NCBI)