Products 16644-54-5

CAS 16644-54-5 is the registry number for 1,6-Bis(tert-butoxycarbonylamino)hexane. Offered by: TRC, Biosynth. Available pack sizes: 1g, 2,5g, 250mg, 0,25g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate (CAS 16644-54-5) is a chemical compound with the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. IUPAC name: tert-butyl N-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate. InChIKey: VDSMPNIBLRKWEG-UHFFFAOYSA-N.

Identity
Molecular formulaC16H32N2O4
Molecular weight316.44 g/mol
IUPAC nametert-butyl N-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate
InChIKeyVDSMPNIBLRKWEG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCCCCCNC(=O)OC(C)(C)C

Computed by PubChem (NCBI)