CAS 82252-39-9 appears in our catalog under these names: Boc-Leu-(?)-Val-OH, Boc–Leu–()–Val–OH. Offered by: Creative Peptides, GLPBio. Available pack sizes: 250mg, 1g, 25g, 5g.
(2S)-3-methyl-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]butanoic acid (CAS 82252-39-9) is a chemical compound with the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. IUPAC name: (2S)-3-methyl-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]butanoic acid. InChIKey: GNQZRCXIDDSAME-STQMWFEESA-N.
| Molecular formula | C16H32N2O4 |
|---|---|
| Molecular weight | 316.44 g/mol |
| IUPAC name | (2S)-3-methyl-2-[[(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]butanoic acid |
| InChIKey | GNQZRCXIDDSAME-STQMWFEESA-N |
| SMILES | CC(C)C[C@@H](CN[C@@H](C(C)C)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)