CAS 166525-56-0 appears in our catalog under these names: 6-{[(tert-Butyldimethylsilyl)oxy]methyl}pyridine-3-carbaldehyde, 95%, 6-(((tert-Butyldimethylsilyl)oxy)methyl)nicotinaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.
6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-3-carbaldehyde (CAS 166525-56-0) is a chemical compound with the molecular formula C13H21NO2Si and a molecular weight of 251.40 g/mol. IUPAC name: 6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-3-carbaldehyde. InChIKey: DADFGOCSPIHMEH-UHFFFAOYSA-N.
| Molecular formula | C13H21NO2Si |
|---|---|
| Molecular weight | 251.40 g/mol |
| IUPAC name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-3-carbaldehyde |
| InChIKey | DADFGOCSPIHMEH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=NC=C(C=C1)C=O |
Computed by PubChem (NCBI)