Products 2891602-14-3
CAS 2891602-14-3 is the registry number for 2-[tert-butyl(dimethyl)silyl]oxy-1-(2-pyridyl)ethanone, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-[tert-butyl(dimethyl)silyl]oxy-1-pyridin-2-ylethanone (CAS 2891602-14-3) is a chemical compound with the molecular formula C13H21NO2Si and a molecular weight of 251.40 g/mol. IUPAC name: 2-[tert-butyl(dimethyl)silyl]oxy-1-pyridin-2-ylethanone. InChIKey: KBRMIFWOGUBFFJ-UHFFFAOYSA-N.
| Molecular formula | C13H21NO2Si |
|---|---|
| Molecular weight | 251.40 g/mol |
| IUPAC name | 2-[tert-butyl(dimethyl)silyl]oxy-1-pyridin-2-ylethanone |
| InChIKey | KBRMIFWOGUBFFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC(=O)C1=CC=CC=N1 |
Computed by PubChem (NCBI)