CAS 1665288-67-4 is the registry number for Benzyl 2,4-dichloro-6,7-dihydropyrido[2,3-d]pyrimidine-8(5H)-carboxylate, 96%, 96%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Benzyl 2,4-dichloro-6,7-dihydro-5H-pyrido[2,3-d]pyrimidine-8-carboxylate (CAS 1665288-67-4) is a chemical compound with the molecular formula C15H13Cl2N3O2 and a molecular weight of 338.2 g/mol. IUPAC name: benzyl 2,4-dichloro-6,7-dihydro-5H-pyrido[2,3-d]pyrimidine-8-carboxylate. InChIKey: RJBGTWTYOSAAOL-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2N3O2 |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | benzyl 2,4-dichloro-6,7-dihydro-5H-pyrido[2,3-d]pyrimidine-8-carboxylate |
| InChIKey | RJBGTWTYOSAAOL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(N=C(N=C2Cl)Cl)N(C1)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)