Products 343240-54-0
CAS 343240-54-0 is the registry number for K+ Channel inhibitor 1734. Offered by: GLPBio. Available pack sizes: 10mg.
Methyl 7-(2,3-dichlorophenyl)-5-methyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxylate (CAS 343240-54-0) is a chemical compound with the molecular formula C15H13Cl2N3O2 and a molecular weight of 338.2 g/mol. IUPAC name: methyl 7-(2,3-dichlorophenyl)-5-methyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxylate. InChIKey: FFVXEFSTAAFKEN-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2N3O2 |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | methyl 7-(2,3-dichlorophenyl)-5-methyl-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxylate |
| InChIKey | FFVXEFSTAAFKEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(N2C(=CC=N2)N1)C3=C(C(=CC=C3)Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)