CAS 16653-19-3 appears in our catalog under these names: 2-(Benzyloxy)isoindoline-1,3-dione, 98%, 2-(Benzyloxy)isoindoline-1,3-dione 98%. Offered by: AmBeed. Available pack sizes: 5g, 50mg, 100mg, 250mg.
2-phenylmethoxyisoindole-1,3-dione (CAS 16653-19-3) is a chemical compound with the molecular formula C15H11NO3 and a molecular weight of 253.25 g/mol. IUPAC name: 2-phenylmethoxyisoindole-1,3-dione. InChIKey: IOZADUIJKWISQS-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 2-phenylmethoxyisoindole-1,3-dione |
| InChIKey | IOZADUIJKWISQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CON2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)