CAS 16654-74-3 appears in our catalog under these names: Bis[2-(trimethylsilyloxy)ethyl] ether, 98%, 2,2,10,10-Tetramethyl-3,6,9-trioxa-2,10-disilaundecane, 98%, Bis(2–(trimethylsilyloxy)ethyl) Ether. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100g, 500g.
Trimethyl-[2-(2-trimethylsilyloxyethoxy)ethoxy]silane (CAS 16654-74-3) is a chemical compound with the molecular formula C10H26O3Si2 and a molecular weight of 250.48 g/mol. IUPAC name: trimethyl-[2-(2-trimethylsilyloxyethoxy)ethoxy]silane. InChIKey: VZCNNAQIFXLAEZ-UHFFFAOYSA-N.
| Molecular formula | C10H26O3Si2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | trimethyl-[2-(2-trimethylsilyloxyethoxy)ethoxy]silane |
| InChIKey | VZCNNAQIFXLAEZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OCCOCCO[Si](C)(C)C |
Computed by PubChem (NCBI)