CAS 18001-97-3 is the registry number for 3,3'-(1,1,3,3-Tetramethyldisiloxane-1,3-diyl)bis(propan-1-ol), 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-[[3-hydroxypropyl(dimethyl)silyl]oxy-dimethylsilyl]propan-1-ol (CAS 18001-97-3) is a chemical compound with the molecular formula C10H26O3Si2 and a molecular weight of 250.48 g/mol. IUPAC name: 3-[[3-hydroxypropyl(dimethyl)silyl]oxy-dimethylsilyl]propan-1-ol. InChIKey: ISPWSRVEMSGMKS-UHFFFAOYSA-N.
| Molecular formula | C10H26O3Si2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 3-[[3-hydroxypropyl(dimethyl)silyl]oxy-dimethylsilyl]propan-1-ol |
| InChIKey | ISPWSRVEMSGMKS-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCCO)O[Si](C)(C)CCCO |
Computed by PubChem (NCBI)