Products 1666124-30-6
CAS 1666124-30-6 is the registry number for Evocalcet Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[4-[(3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]acetate (CAS 1666124-30-6) is a chemical compound with the molecular formula C26H30N2O2 and a molecular weight of 402.5 g/mol. IUPAC name: ethyl 2-[4-[(3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]acetate. InChIKey: DSDQMTYRGQOIEX-KNQAVFIVSA-N.
| Molecular formula | C26H30N2O2 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | ethyl 2-[4-[(3S)-3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]phenyl]acetate |
| InChIKey | DSDQMTYRGQOIEX-KNQAVFIVSA-N |
| SMILES | CCOC(=O)CC1=CC=C(C=C1)N2CC[C@@H](C2)N[C@H](C)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)