Products 1348822-76-3
CAS 1348822-76-3 is the registry number for Levocabastine Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-1-(4-cyano-4-phenylcyclohexyl)-3-methyl-4-phenylpiperidine-4-carboxylic acid (CAS 1348822-76-3) is a chemical compound with the molecular formula C26H30N2O2 and a molecular weight of 402.5 g/mol. IUPAC name: (3S,4R)-1-(4-cyano-4-phenylcyclohexyl)-3-methyl-4-phenylpiperidine-4-carboxylic acid. InChIKey: SACWPKNNCWGCEU-UOATUGCDSA-N.
| Molecular formula | C26H30N2O2 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | (3S,4R)-1-(4-cyano-4-phenylcyclohexyl)-3-methyl-4-phenylpiperidine-4-carboxylic acid |
| InChIKey | SACWPKNNCWGCEU-UOATUGCDSA-N |
| SMILES | C[C@@H]1CN(CC[C@@]1(C2=CC=CC=C2)C(=O)O)C3CCC(CC3)(C#N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)