CAS 2924824-48-4 appears in our catalog under these names: AChE/BChE-IN-10, 98%, AChE/BChE-IN-10/ 99.75% (existing batch purity), AChE/BChE-IN-10 98%, N-(2-(1-benzylpiperidin-4-yl)ethyl)-6-methoxy-2-naphthamide, 98%, 98%, AChE/BChE-IN-10, 99.67%. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 5 mg, 25 mg.
N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-methoxynaphthalene-2-carboxamide (CAS 2924824-48-4) is a chemical compound with the molecular formula C26H30N2O2 and a molecular weight of 402.5 g/mol. IUPAC name: N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-methoxynaphthalene-2-carboxamide. InChIKey: AIIWJMPOAUNFLG-UHFFFAOYSA-N.
| Molecular formula | C26H30N2O2 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | N-[2-(1-benzylpiperidin-4-yl)ethyl]-6-methoxynaphthalene-2-carboxamide |
| InChIKey | AIIWJMPOAUNFLG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C(=O)NCCC3CCN(CC3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)