CAS 1667753-66-3 is the registry number for (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-6-fluoro-3-pyridinepropanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-fluoro-3-pyridinyl)propanoic acid (CAS 1667753-66-3) is a chemical compound with the molecular formula C23H19FN2O4 and a molecular weight of 406.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-fluoro-3-pyridinyl)propanoic acid. InChIKey: BOVDIXKRWSEYHI-FQEVSTJZSA-N.
| Molecular formula | C23H19FN2O4 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(6-fluoro-3-pyridinyl)propanoic acid |
| InChIKey | BOVDIXKRWSEYHI-FQEVSTJZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CN=C(C=C4)F)C(=O)O |
Computed by PubChem (NCBI)