Products 2378380-49-3
CAS 2378380-49-3 appears in our catalog under these names: Pelecopan, Pelecopan, 98.07%, Pelecopan, 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 10mg, 25 mg, 10 mg, 100 mg, 50 mg.
2-[2-[[7-[2-(aminomethyl)-3-fluoro-4-pyridinyl]-1-benzofuran-5-yl]methoxy]phenyl]acetic acid (CAS 2378380-49-3) is a chemical compound with the molecular formula C23H19FN2O4 and a molecular weight of 406.4 g/mol. IUPAC name: 2-[2-[[7-[2-(aminomethyl)-3-fluoro-4-pyridinyl]-1-benzofuran-5-yl]methoxy]phenyl]acetic acid. InChIKey: AUARNXJEAZFQCQ-UHFFFAOYSA-N.
| Molecular formula | C23H19FN2O4 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | 2-[2-[[7-[2-(aminomethyl)-3-fluoro-4-pyridinyl]-1-benzofuran-5-yl]methoxy]phenyl]acetic acid |
| InChIKey | AUARNXJEAZFQCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)OCC2=CC(=C3C(=C2)C=CO3)C4=C(C(=NC=C4)CN)F |
Computed by PubChem (NCBI)