Products 1668-85-5
CAS 1668-85-5 appears in our catalog under these names: Galantamine EP Impurity B (epi-Galantamine), Galantamine Impurity 2（Galantamine EP Impurity B）, Epi Galanthamine, >95% (HPLC), Epi-galantamine/ 99.07% (existing batch purity), Epi-galanthamine. Offered by: Chemat Brand, Hubei YoungXin, TRC, TargetMol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 1mg.
(1S,12S,14S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol (CAS 1668-85-5) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 287.35 g/mol. IUPAC name: (1S,12S,14S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol. InChIKey: ASUTZQLVASHGKV-IFIJOSMWSA-N.
| Molecular formula | C17H21NO3 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | (1S,12S,14S)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
| InChIKey | ASUTZQLVASHGKV-IFIJOSMWSA-N |
| SMILES | CN1CC[C@@]23C=C[C@H](C[C@@H]2OC4=C(C=CC(=C34)C1)OC)O |
Computed by PubChem (NCBI)