Products 866137-08-8

CAS 866137-08-8 is the registry number for 3-Cyclohexyl-3-(1-oxo-2,3-dihydro-1h-isoindol-2-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-cyclohexyl-3-(3-oxo-1H-isoindol-2-yl)propanoic acid (CAS 866137-08-8) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 287.35 g/mol. IUPAC name: 3-cyclohexyl-3-(3-oxo-1H-isoindol-2-yl)propanoic acid. InChIKey: VHRLDJZOBGSADS-UHFFFAOYSA-N.

Identity
Molecular formulaC17H21NO3
Molecular weight287.35 g/mol
IUPAC name3-cyclohexyl-3-(3-oxo-1H-isoindol-2-yl)propanoic acid
InChIKeyVHRLDJZOBGSADS-UHFFFAOYSA-N
SMILESC1CCC(CC1)C(CC(=O)O)N2CC3=CC=CC=C3C2=O

Computed by PubChem (NCBI)