Products 16682-30-7

CAS 16682-30-7 is the registry number for 10-p-Tolyl-10H-phenothiazine 5,5-dioxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

10-(4-methylphenyl)phenothiazine 5,5-dioxide (CAS 16682-30-7) is a chemical compound with the molecular formula C19H15NO2S and a molecular weight of 321.4 g/mol. IUPAC name: 10-(4-methylphenyl)phenothiazine 5,5-dioxide. InChIKey: ZFIKHMPKEXFIMK-UHFFFAOYSA-N.

Identity
Molecular formulaC19H15NO2S
Molecular weight321.4 g/mol
IUPAC name10-(4-methylphenyl)phenothiazine 5,5-dioxide
InChIKeyZFIKHMPKEXFIMK-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)N2C3=CC=CC=C3S(=O)(=O)C4=CC=CC=C42

Computed by PubChem (NCBI)