CAS 16682-30-7 is the registry number for 10-p-Tolyl-10H-phenothiazine 5,5-dioxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
10-(4-methylphenyl)phenothiazine 5,5-dioxide (CAS 16682-30-7) is a chemical compound with the molecular formula C19H15NO2S and a molecular weight of 321.4 g/mol. IUPAC name: 10-(4-methylphenyl)phenothiazine 5,5-dioxide. InChIKey: ZFIKHMPKEXFIMK-UHFFFAOYSA-N.
| Molecular formula | C19H15NO2S |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 10-(4-methylphenyl)phenothiazine 5,5-dioxide |
| InChIKey | ZFIKHMPKEXFIMK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C3=CC=CC=C3S(=O)(=O)C4=CC=CC=C42 |
Computed by PubChem (NCBI)