CAS 263389-20-4 is the registry number for 2-[Isocyano-(toluene-4-sulfonyl)-methyl]-naphthalene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-[isocyano-(4-methylphenyl)sulfonylmethyl]naphthalene (CAS 263389-20-4) is a chemical compound with the molecular formula C19H15NO2S and a molecular weight of 321.4 g/mol. IUPAC name: 2-[isocyano-(4-methylphenyl)sulfonylmethyl]naphthalene. InChIKey: RHYRPXMKRMBYNK-UHFFFAOYSA-N.
| Molecular formula | C19H15NO2S |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 2-[isocyano-(4-methylphenyl)sulfonylmethyl]naphthalene |
| InChIKey | RHYRPXMKRMBYNK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC3=CC=CC=C3C=C2)[N+]#[C-] |
Computed by PubChem (NCBI)