CAS 166940-44-9 appears in our catalog under these names: (1R)-1-(2,4-Dimethylphenyl)ethan-1-ol, 95%, (1R)-1-(2,4-Dimethylphenyl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
(1R)-1-(2,4-dimethylphenyl)ethanol (CAS 166940-44-9) is a chemical compound with the molecular formula C10H14O and a molecular weight of 150.22 g/mol. IUPAC name: (1R)-1-(2,4-dimethylphenyl)ethanol. InChIKey: DNHQUGRUHBFDFT-SECBINFHSA-N.
| Molecular formula | C10H14O |
|---|---|
| Molecular weight | 150.22 g/mol |
| IUPAC name | (1R)-1-(2,4-dimethylphenyl)ethanol |
| InChIKey | DNHQUGRUHBFDFT-SECBINFHSA-N |
| SMILES | CC1=CC(=C(C=C1)[C@@H](C)O)C |
Computed by PubChem (NCBI)