CAS 168749-62-0 is the registry number for (1S)-1-(2,4-Dimethylphenyl)ethan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(1S)-1-(2,4-dimethylphenyl)ethanol (CAS 168749-62-0) is a chemical compound with the molecular formula C10H14O and a molecular weight of 150.22 g/mol. IUPAC name: (1S)-1-(2,4-dimethylphenyl)ethanol. InChIKey: DNHQUGRUHBFDFT-VIFPVBQESA-N.
| Molecular formula | C10H14O |
|---|---|
| Molecular weight | 150.22 g/mol |
| IUPAC name | (1S)-1-(2,4-dimethylphenyl)ethanol |
| InChIKey | DNHQUGRUHBFDFT-VIFPVBQESA-N |
| SMILES | CC1=CC(=C(C=C1)[C@H](C)O)C |
Computed by PubChem (NCBI)