CAS 16695-57-1 is the registry number for N,N-Diethyldichloroacetoacetamide. Offered by: TRC. Available pack sizes: 100mg.
2,2-dichloro-N,N-diethyl-3-oxobutanamide (CAS 16695-57-1) is a chemical compound with the molecular formula C8H13Cl2NO2 and a molecular weight of 226.10 g/mol. IUPAC name: 2,2-dichloro-N,N-diethyl-3-oxobutanamide. InChIKey: FDPMTHLEABSCPU-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2NO2 |
|---|---|
| Molecular weight | 226.10 g/mol |
| IUPAC name | 2,2-dichloro-N,N-diethyl-3-oxobutanamide |
| InChIKey | FDPMTHLEABSCPU-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C(C(=O)C)(Cl)Cl |
Computed by PubChem (NCBI)