Products 2375270-82-7

CAS 2375270-82-7 is the registry number for 1-Chloro-6-azaspiro(2.5)octane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-chloro-6-azaspiro[2.5]octane-2-carboxylic acid;hydrochloride (CAS 2375270-82-7) is a chemical compound with the molecular formula C8H13Cl2NO2 and a molecular weight of 226.10 g/mol. IUPAC name: 2-chloro-6-azaspiro[2.5]octane-2-carboxylic acid;hydrochloride. InChIKey: MVGANIMBWFVVIN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13Cl2NO2
Molecular weight226.10 g/mol
IUPAC name2-chloro-6-azaspiro[2.5]octane-2-carboxylic acid;hydrochloride
InChIKeyMVGANIMBWFVVIN-UHFFFAOYSA-N
SMILESC1CNCCC12CC2(C(=O)O)Cl.Cl

Computed by PubChem (NCBI)