CAS 166964-35-8 appears in our catalog under these names: 4-Bromo-5-chlorothiophene-2-sulfonyl chloride, 95%, 3-Bromo-2-chlorothiophene-5-sulphonyl chloride, 4-Bromo-5-chlorothiophene-2-sulfonyl chloride, 95% , 4-Bromo-5-chlorothiophene-2-sulfonyl chloride 97%, 4-Bromo-5-chlorothiophene-2-sulfonyl chloride, 97%. Offered by: Combi-blocks, Biosynth, Thermo Scientific, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 0,25g, 2,5g, 250MG.
4-bromo-5-chlorothiophene-2-sulfonyl chloride (CAS 166964-35-8) is a chemical compound with the molecular formula C4HBrCl2O2S2 and a molecular weight of 296.0 g/mol. IUPAC name: 4-bromo-5-chlorothiophene-2-sulfonyl chloride. InChIKey: PABOKJJDABSQCK-UHFFFAOYSA-N.
| Molecular formula | C4HBrCl2O2S2 |
|---|---|
| Molecular weight | 296.0 g/mol |
| IUPAC name | 4-bromo-5-chlorothiophene-2-sulfonyl chloride |
| InChIKey | PABOKJJDABSQCK-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Br)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)