CAS 175205-72-8 appears in our catalog under these names: 3-Bromo-5-chlorothiophene-2-sulfonyl chloride, 95%, 3-Bromo-5-chlorothiophene-2-sulfonylchloride, 97%, 3-Bromo-5-chlorothiophene-2-sulfonyl chloride 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-bromo-5-chlorothiophene-2-sulfonyl chloride (CAS 175205-72-8) is a chemical compound with the molecular formula C4HBrCl2O2S2 and a molecular weight of 296.0 g/mol. IUPAC name: 3-bromo-5-chlorothiophene-2-sulfonyl chloride. InChIKey: IJWGXKAPAGXFRO-UHFFFAOYSA-N.
| Molecular formula | C4HBrCl2O2S2 |
|---|---|
| Molecular weight | 296.0 g/mol |
| IUPAC name | 3-bromo-5-chlorothiophene-2-sulfonyl chloride |
| InChIKey | IJWGXKAPAGXFRO-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Br)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)