CAS 16706-41-5 appears in our catalog under these names: Z–His–NH₂, Z-His-nh2, 98%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 5g, 1g.
Benzyl N-[(2S)-1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (CAS 16706-41-5) is a chemical compound with the molecular formula C14H16N4O3 and a molecular weight of 288.30 g/mol. IUPAC name: benzyl N-[(2S)-1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate. InChIKey: YLVGCKUYWFCKIV-LBPRGKRZSA-N.
| Molecular formula | C14H16N4O3 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | benzyl N-[(2S)-1-amino-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| InChIKey | YLVGCKUYWFCKIV-LBPRGKRZSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CN=CN2)C(=O)N |
Computed by PubChem (NCBI)