Products 2925075-63-2
CAS 2925075-63-2 is the registry number for CRBN ligand-698. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-(2-aminoethyl)-3-oxo-1H-isoindol-5-yl]-1,3-diazinane-2,4-dione (CAS 2925075-63-2) is a chemical compound with the molecular formula C14H16N4O3 and a molecular weight of 288.30 g/mol. IUPAC name: 1-[2-(2-aminoethyl)-3-oxo-1H-isoindol-5-yl]-1,3-diazinane-2,4-dione. InChIKey: AMGGXSPZJKKNDH-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O3 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | 1-[2-(2-aminoethyl)-3-oxo-1H-isoindol-5-yl]-1,3-diazinane-2,4-dione |
| InChIKey | AMGGXSPZJKKNDH-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC3=C(CN(C3=O)CCN)C=C2 |
Computed by PubChem (NCBI)