Products 1670924-15-8
CAS 1670924-15-8 is the registry number for Dimethyl 4',5'-diethynyl-[1,1':2',1''-terphenyl]-4,4''-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-[4,5-diethynyl-2-(4-methoxycarbonylphenyl)phenyl]benzoate (CAS 1670924-15-8) is a chemical compound with the molecular formula C26H18O4 and a molecular weight of 394.4 g/mol. IUPAC name: methyl 4-[4,5-diethynyl-2-(4-methoxycarbonylphenyl)phenyl]benzoate. InChIKey: OSAYQCSPHVHRKA-UHFFFAOYSA-N.
| Molecular formula | C26H18O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | methyl 4-[4,5-diethynyl-2-(4-methoxycarbonylphenyl)phenyl]benzoate |
| InChIKey | OSAYQCSPHVHRKA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=C(C=C(C(=C2)C#C)C#C)C3=CC=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)