CAS 143613-17-6 appears in our catalog under these names: (1,1':4',1'':4'',1'''-Quaterphenyl)-4,4'''-dicarboxylic Acid, (1,1':4',1'':4'',1'''–Quaterphenyl)–4,4'''–dicarboxylic acid, [1,1':4',1'':4'',1'''-Quaterphenyl]-4,4'''-dicarboxylicacid, 98%, 98%, [1,1':4',1'':4'',1'''-Quaterphenyl]-4,4'''-dicarboxylic acid, 98%. Offered by: TRC, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-[4-[4-(4-carboxyphenyl)phenyl]phenyl]benzoic acid (CAS 143613-17-6) is a chemical compound with the molecular formula C26H18O4 and a molecular weight of 394.4 g/mol. IUPAC name: 4-[4-[4-(4-carboxyphenyl)phenyl]phenyl]benzoic acid. InChIKey: HKNHBZNRYLZPMH-UHFFFAOYSA-N.
| Molecular formula | C26H18O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 4-[4-[4-(4-carboxyphenyl)phenyl]phenyl]benzoic acid |
| InChIKey | HKNHBZNRYLZPMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C3=CC=C(C=C3)C(=O)O)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)