Products 201666-59-3
CAS 201666-59-3 appears in our catalog under these names: 5'-Phenyl-[1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid, 98%, 98%, [1,1′:3′,1′′-Terphenyl]-4,4′′-dicarboxylic acid, 5′-phenyl-, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-[3-(4-carboxyphenyl)-5-phenylphenyl]benzoic acid (CAS 201666-59-3) is a chemical compound with the molecular formula C26H18O4 and a molecular weight of 394.4 g/mol. IUPAC name: 4-[3-(4-carboxyphenyl)-5-phenylphenyl]benzoic acid. InChIKey: XVKHZAAJOPDUSV-UHFFFAOYSA-N.
| Molecular formula | C26H18O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 4-[3-(4-carboxyphenyl)-5-phenylphenyl]benzoic acid |
| InChIKey | XVKHZAAJOPDUSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC=C(C=C3)C(=O)O)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)