Products 167158-17-0
CAS 167158-17-0 is the registry number for 6-Chloro-2-isopropoxy-3-propylquinazolin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-2-propan-2-yloxy-3-propylquinazolin-4-one (CAS 167158-17-0) is a chemical compound with the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. IUPAC name: 6-chloro-2-propan-2-yloxy-3-propylquinazolin-4-one. InChIKey: FKIWIGIKNOOPRU-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2O2 |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | 6-chloro-2-propan-2-yloxy-3-propylquinazolin-4-one |
| InChIKey | FKIWIGIKNOOPRU-UHFFFAOYSA-N |
| SMILES | CCCN1C(=O)C2=C(C=CC(=C2)Cl)N=C1OC(C)C |
Computed by PubChem (NCBI)