CAS 16718-23-3 appears in our catalog under these names: (S(R)-)-S-(1E)-1-Propen-1-Yl-L-Cysteine S-Oxide, (R)–1–PeCSO, (R)-1-PeCSO, ≥98%, ≥98%, (R)-1-PeCSO, 99.50%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 500mg, 1mg, 5mg, 1 mg, 5 mg, 10 mg.
(2R)-2-amino-3-[(R)-[(E)-prop-1-enyl]sulfinyl]propanoic acid (CAS 16718-23-3) is a chemical compound with the molecular formula C6H11NO3S and a molecular weight of 177.22 g/mol. IUPAC name: (2R)-2-amino-3-[(R)-[(E)-prop-1-enyl]sulfinyl]propanoic acid. InChIKey: OKYHUOHBRKWCQJ-UUEXCLNXSA-N.
| Molecular formula | C6H11NO3S |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | (2R)-2-amino-3-[(R)-[(E)-prop-1-enyl]sulfinyl]propanoic acid |
| InChIKey | OKYHUOHBRKWCQJ-UUEXCLNXSA-N |
| SMILES | C/C=C/[S@](=O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)