CAS 1672-59-9 appears in our catalog under these names: 4-Formyl Methylamino Antipyrine (FMAA), Antipyrine Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N-methylformamide (CAS 1672-59-9) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N-methylformamide. InChIKey: YYAPJRMMCIUAAC-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N-methylformamide |
| InChIKey | YYAPJRMMCIUAAC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N(C)C=O |
Computed by PubChem (NCBI)