CAS 1672665-00-7 is the registry number for (3-bromo-2,4-dichlorophenyl)(methyl)sulfane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1,3-dichloro-4-methylsulfanylbenzene (CAS 1672665-00-7) is a chemical compound with the molecular formula C7H5BrCl2S and a molecular weight of 271.99 g/mol. IUPAC name: 2-bromo-1,3-dichloro-4-methylsulfanylbenzene. InChIKey: KWPUROVALCKKHF-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2S |
|---|---|
| Molecular weight | 271.99 g/mol |
| IUPAC name | 2-bromo-1,3-dichloro-4-methylsulfanylbenzene |
| InChIKey | KWPUROVALCKKHF-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)Cl)Br)Cl |
Computed by PubChem (NCBI)