CAS 214283-19-9 is the registry number for 4-Bromo-2,3-dichlorothioanisole, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 100g.
1-bromo-2,3-dichloro-4-methylsulfanylbenzene (CAS 214283-19-9) is a chemical compound with the molecular formula C7H5BrCl2S and a molecular weight of 271.99 g/mol. IUPAC name: 1-bromo-2,3-dichloro-4-methylsulfanylbenzene. InChIKey: YKUWFLWEYWBCKA-UHFFFAOYSA-N.
| Molecular formula | C7H5BrCl2S |
|---|---|
| Molecular weight | 271.99 g/mol |
| IUPAC name | 1-bromo-2,3-dichloro-4-methylsulfanylbenzene |
| InChIKey | YKUWFLWEYWBCKA-UHFFFAOYSA-N |
| SMILES | CSC1=C(C(=C(C=C1)Br)Cl)Cl |
Computed by PubChem (NCBI)