Products 214283-19-9

CAS 214283-19-9 is the registry number for 4-Bromo-2,3-dichlorothioanisole, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 100g.

Structural formula: {0} (CAS {1})

1-bromo-2,3-dichloro-4-methylsulfanylbenzene (CAS 214283-19-9) is a chemical compound with the molecular formula C7H5BrCl2S and a molecular weight of 271.99 g/mol. IUPAC name: 1-bromo-2,3-dichloro-4-methylsulfanylbenzene. InChIKey: YKUWFLWEYWBCKA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrCl2S
Molecular weight271.99 g/mol
IUPAC name1-bromo-2,3-dichloro-4-methylsulfanylbenzene
InChIKeyYKUWFLWEYWBCKA-UHFFFAOYSA-N
SMILESCSC1=C(C(=C(C=C1)Br)Cl)Cl

Computed by PubChem (NCBI)