CAS 167298-42-2 appears in our catalog under these names: (S)-N-Cbz-1-(aminomethyl)-2-phenylethylamine, 95%, (S)–benzyl 1–amino–3–phenylpropan–2–ylcarbamate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
Benzyl N-[(2S)-1-amino-3-phenylpropan-2-yl]carbamate (CAS 167298-42-2) is a chemical compound with the molecular formula C17H20N2O2 and a molecular weight of 284.35 g/mol. IUPAC name: benzyl N-[(2S)-1-amino-3-phenylpropan-2-yl]carbamate. InChIKey: RFHWUYIUCANZPA-INIZCTEOSA-N.
| Molecular formula | C17H20N2O2 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | benzyl N-[(2S)-1-amino-3-phenylpropan-2-yl]carbamate |
| InChIKey | RFHWUYIUCANZPA-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CN)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)