Products 931666-01-2
CAS 931666-01-2 is the registry number for 6-(Morpholin-4-ylcarbonyl)-2,3,4,9-tetrahydro-1h-carbazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Morpholin-4-yl(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone (CAS 931666-01-2) is a chemical compound with the molecular formula C17H20N2O2 and a molecular weight of 284.35 g/mol. IUPAC name: morpholin-4-yl(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone. InChIKey: DGDMGQDMPXLFFE-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O2 |
|---|---|
| Molecular weight | 284.35 g/mol |
| IUPAC name | morpholin-4-yl(6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanone |
| InChIKey | DGDMGQDMPXLFFE-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N2)C=CC(=C3)C(=O)N4CCOCC4 |
Computed by PubChem (NCBI)