Products 16738-07-1

CAS 16738-07-1 is the registry number for (2,4-Dibromophenoxy)acetyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2,4-dibromophenoxy)acetyl chloride (CAS 16738-07-1) is a chemical compound with the molecular formula C8H5Br2ClO2 and a molecular weight of 328.38 g/mol. IUPAC name: 2-(2,4-dibromophenoxy)acetyl chloride. InChIKey: ABJOJUXBOIRTBS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5Br2ClO2
Molecular weight328.38 g/mol
IUPAC name2-(2,4-dibromophenoxy)acetyl chloride
InChIKeyABJOJUXBOIRTBS-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)Br)OCC(=O)Cl

Computed by PubChem (NCBI)