CAS 16738-07-1 is the registry number for (2,4-Dibromophenoxy)acetyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(2,4-dibromophenoxy)acetyl chloride (CAS 16738-07-1) is a chemical compound with the molecular formula C8H5Br2ClO2 and a molecular weight of 328.38 g/mol. IUPAC name: 2-(2,4-dibromophenoxy)acetyl chloride. InChIKey: ABJOJUXBOIRTBS-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2ClO2 |
|---|---|
| Molecular weight | 328.38 g/mol |
| IUPAC name | 2-(2,4-dibromophenoxy)acetyl chloride |
| InChIKey | ABJOJUXBOIRTBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Br)OCC(=O)Cl |
Computed by PubChem (NCBI)