Products 1839608-72-8

CAS 1839608-72-8 is the registry number for methyl 3,5-dibromo-4-chlorobenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3,5-dibromo-4-chlorobenzoate (CAS 1839608-72-8) is a chemical compound with the molecular formula C8H5Br2ClO2 and a molecular weight of 328.38 g/mol. IUPAC name: methyl 3,5-dibromo-4-chlorobenzoate. InChIKey: SPHVFHMFPNBSNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5Br2ClO2
Molecular weight328.38 g/mol
IUPAC namemethyl 3,5-dibromo-4-chlorobenzoate
InChIKeySPHVFHMFPNBSNZ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C(=C1)Br)Cl)Br

Computed by PubChem (NCBI)