CAS 1839608-72-8 is the registry number for methyl 3,5-dibromo-4-chlorobenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3,5-dibromo-4-chlorobenzoate (CAS 1839608-72-8) is a chemical compound with the molecular formula C8H5Br2ClO2 and a molecular weight of 328.38 g/mol. IUPAC name: methyl 3,5-dibromo-4-chlorobenzoate. InChIKey: SPHVFHMFPNBSNZ-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2ClO2 |
|---|---|
| Molecular weight | 328.38 g/mol |
| IUPAC name | methyl 3,5-dibromo-4-chlorobenzoate |
| InChIKey | SPHVFHMFPNBSNZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)Cl)Br |
Computed by PubChem (NCBI)