CAS 167423-51-0 appears in our catalog under these names: 6,7–Dimethyltetrahydropterin (hydrochloride), cis-6,7-Dimethyl-5,6,7,8-tetrahydropterin hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 10mg, 100mg, 50mg, 500mg, 2g, 1g, 5g.
2-amino-6,7-dimethyl-5,6,7,8-tetrahydro-3H-pteridin-4-one;hydrochloride (CAS 167423-51-0) is a chemical compound with the molecular formula C8H14ClN5O and a molecular weight of 231.68 g/mol. IUPAC name: 2-amino-6,7-dimethyl-5,6,7,8-tetrahydro-3H-pteridin-4-one;hydrochloride. InChIKey: GIHYTRGUZVYCQX-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN5O |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 2-amino-6,7-dimethyl-5,6,7,8-tetrahydro-3H-pteridin-4-one;hydrochloride |
| InChIKey | GIHYTRGUZVYCQX-UHFFFAOYSA-N |
| SMILES | CC1C(NC2=C(N1)C(=O)NC(=N2)N)C.Cl |
Computed by PubChem (NCBI)