CAS 66547-54-4 is the registry number for Cis-2-amino-6,7-dimethyl-5,6,7,8-tetrahydropteridin-4(1H)-one xhydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6R,7S)-2-amino-6,7-dimethyl-5,6,7,8-tetrahydro-3H-pteridin-4-one;hydrochloride (CAS 66547-54-4) is a chemical compound with the molecular formula C8H14ClN5O and a molecular weight of 231.68 g/mol. IUPAC name: (6R,7S)-2-amino-6,7-dimethyl-5,6,7,8-tetrahydro-3H-pteridin-4-one;hydrochloride. InChIKey: GIHYTRGUZVYCQX-HJXLNUONSA-N.
| Molecular formula | C8H14ClN5O |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | (6R,7S)-2-amino-6,7-dimethyl-5,6,7,8-tetrahydro-3H-pteridin-4-one;hydrochloride |
| InChIKey | GIHYTRGUZVYCQX-HJXLNUONSA-N |
| SMILES | C[C@@H]1[C@@H](NC2=C(N1)C(=O)NC(=N2)N)C.Cl |
Computed by PubChem (NCBI)