Products 1674364-30-7
CAS 1674364-30-7 appears in our catalog under these names: 4-Bromo-2-ethylphenylboronic acid pinacol ester, 95%, 2-(4-bromo-2-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(4-bromo-2-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1674364-30-7) is a chemical compound with the molecular formula C14H20BBrO2 and a molecular weight of 311.02 g/mol. IUPAC name: 2-(4-bromo-2-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IVMWFBWQBOCRGY-UHFFFAOYSA-N.
| Molecular formula | C14H20BBrO2 |
|---|---|
| Molecular weight | 311.02 g/mol |
| IUPAC name | 2-(4-bromo-2-ethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IVMWFBWQBOCRGY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Br)CC |
Computed by PubChem (NCBI)