CAS 2121511-79-1 appears in our catalog under these names: 4-Bromo-2,6-dimethylphenylboronic acid pinacol ester, 95%, 2-(4-Bromo-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2-(4-Bromo-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 100mg.
2-(4-bromo-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121511-79-1) is a chemical compound with the molecular formula C14H20BBrO2 and a molecular weight of 311.02 g/mol. IUPAC name: 2-(4-bromo-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FKMZCJJZTNMHSH-UHFFFAOYSA-N.
| Molecular formula | C14H20BBrO2 |
|---|---|
| Molecular weight | 311.02 g/mol |
| IUPAC name | 2-(4-bromo-2,6-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FKMZCJJZTNMHSH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2C)Br)C |
Computed by PubChem (NCBI)