CAS 1675732-80-5 is the registry number for Bis(2-ethylhexyl) Phthalate-13C6. Offered by: TRC. Available pack sizes: 50mg.
Bis(2-ethylhexyl) (1,2,3,4,5,6-13C6)cyclohexa-2,4,6-triene-1,2-dicarboxylate (CAS 1675732-80-5) is a chemical compound with the molecular formula C24H38O4 and a molecular weight of 396.5 g/mol. IUPAC name: bis(2-ethylhexyl) (1,2,3,4,5,6-13C6)cyclohexa-2,4,6-triene-1,2-dicarboxylate. InChIKey: BJQHLKABXJIVAM-GAOGTBERSA-N.
| Molecular formula | C24H38O4 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | bis(2-ethylhexyl) (1,2,3,4,5,6-13C6)cyclohexa-2,4,6-triene-1,2-dicarboxylate |
| InChIKey | BJQHLKABXJIVAM-GAOGTBERSA-N |
| SMILES | CCCCC(CC)COC(=O)[13C]1=[13CH][13CH]=[13CH][13CH]=[13C]1C(=O)OCC(CC)CCCC |
Computed by PubChem (NCBI)